C14H13F3N4O3 — CID 43935386
N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-(trifluoromethyl)benzohydrazide (PubChem CID 43935386) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 43935386 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-(trifluoromethyl)benzohydrazide |
| SMILES | Cn1c(NNC(=O)c2ccccc2C(F)(F)F)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H13F3N4O3/c1-20-10(7-11(22)21(2)13(20)24)18-19-12(23)8-5-3-4-6-9(8)14(15,16)17/h3-7,18H,1-2H3,(H,19,23) |
| InChIKey | HGGBRAORONNTLY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|