C15H18N4O4 — CID 2145310
N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-ethoxybenzohydrazide (PubChem CID 2145310) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-ethoxybenzohydrazide.
| Compound Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-ethoxybenzohydrazide |
|---|---|
| PubChem CID | 2145310 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-ethoxybenzohydrazide |
| SMILES | CCOc1ccccc1C(=O)NNc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C15H18N4O4/c1-4-23-11-8-6-5-7-10(11)14(21)17-16-12-9-13(20)19(3)15(22)18(12)2/h5-9,16H,4H2,1-3H3,(H,17,21) |
| InChIKey | BGBZPQKTUVPKFZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|