C14H15ClN4O4 — CID 2145324
5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methoxybenzohydrazide (PubChem CID 2145324) has the molecular formula C14H15ClN4O4 and a molecular weight of 338.75 g/mol. Its IUPAC name is 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 2145324 |
| Molecular Formula | C14H15ClN4O4 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H15ClN4O4/c1-18-11(7-12(20)19(2)14(18)22)16-17-13(21)9-6-8(15)4-5-10(9)23-3/h4-7,16H,1-3H3,(H,17,21) |
| InChIKey | WEWWIKLWWDSGEM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|