C17H17ClN6O5 — CID 4010068
5-chloro-N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-methoxybenzohydrazide (PubChem CID 4010068) has the molecular formula C17H17ClN6O5 and a molecular weight of 420.81 g/mol. Its IUPAC name is 5-chloro-N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-methoxybenzohydrazide.
| Compound Name | 5-chloro-N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 4010068 |
| Molecular Formula | C17H17ClN6O5 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-chloro-N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H17ClN6O5/c1-22-14-13(16(27)23(2)17(22)28)24(8-19-14)7-12(25)20-21-15(26)10-6-9(18)4-5-11(10)29-3/h4-6,8H,7H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | KDPQFYRJJGFWCN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|