C19H22N6O5 — CID 1387162
N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 1387162) has the molecular formula C19H22N6O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 1387162 |
| Molecular Formula | C19H22N6O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethylideneamino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | COc1ccc(C(C)=NNC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C19H22N6O5/c1-11(12-6-7-13(29-4)14(8-12)30-5)21-22-15(26)9-25-10-20-17-16(25)18(27)24(3)19(28)23(17)2/h6-8,10H,9H2,1-5H3,(H,22,26) |
| InChIKey | WONPOPMFJKATOH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 121.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|