C19H25N6O4+ — CID 6342638
[1-amino-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]-[2-(3,4-dimethoxyphenyl)ethyl]azanium (PubChem CID 6342638) has the molecular formula C19H25N6O4+ and a molecular weight of 401.45 g/mol. Its IUPAC name is [1-amino-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]-[2-(3,4-dimethoxyphenyl)ethyl]azanium.
| Compound Name | [1-amino-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 6342638 |
| Molecular Formula | C19H25N6O4+ |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | [1-amino-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethylidene]-[2-(3,4-dimethoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc(CC/[NH+]=C(\N)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1OC |
| InChI | InChI=1S/C19H24N6O4/c1-23-17-16(18(26)24(2)19(23)27)25(11-22-17)10-15(20)21-8-7-12-5-6-13(28-3)14(9-12)29-4/h5-6,9,11H,7-8,10H2,1-4H3,(H2,20,21)/p+1 |
| InChIKey | HZMQPTOYOOWVQW-UHFFFAOYSA-O |
| XLogP | -1.87 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|