C17H18N4O5 — CID 18195122
7-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 18195122) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 7-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 18195122 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 7-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(OC)c(C(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C17H18N4O5/c1-19-15-14(16(23)20(2)17(19)24)21(9-18-15)8-12(22)11-7-10(25-3)5-6-13(11)26-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | SBHYWQYOJYCXQH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 97.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |