C15H13FN4O3 — CID 7856335
7-[2-(2-fluorophenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 7856335) has the molecular formula C15H13FN4O3 and a molecular weight of 316.29 g/mol. Its IUPAC name is 7-[2-(2-fluorophenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-(2-fluorophenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 7856335 |
| Molecular Formula | C15H13FN4O3 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 7-[2-(2-fluorophenyl)-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)c2ccccc2F)n(C)c1=O |
| InChI | InChI=1S/C15H13FN4O3/c1-18-13-12(14(22)19(2)15(18)23)20(8-17-13)7-11(21)9-5-3-4-6-10(9)16/h3-6,8H,7H2,1-2H3 |
| InChIKey | MWNVAZOMGWXASC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |