C9H12N6O3 — CID 3057490
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-hydroxyethanimidamide (PubChem CID 3057490) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 3057490 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N'-hydroxyethanimidamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(N)=NO)n(C)c1=O |
| InChI | InChI=1S/C9H12N6O3/c1-13-7-6(8(16)14(2)9(13)17)15(4-11-7)3-5(10)12-18/h4,18H,3H2,1-2H3,(H2,10,12) |
| InChIKey | JSGKUNQWGYLLLG-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|