C19H20N6O5 — CID 1391141
[4-[N-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate (PubChem CID 1391141) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is [4-[N-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate.
| Compound Name | [4-[N-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate |
|---|---|
| PubChem CID | 1391141 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [4-[N-[[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]amino]-C-methylcarbonimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(C)=NNC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C19H20N6O5/c1-11(13-5-7-14(8-6-13)30-12(2)26)21-22-15(27)9-25-10-20-17-16(25)18(28)24(4)19(29)23(17)3/h5-8,10H,9H2,1-4H3,(H,22,27) |
| InChIKey | CLEVKTOOTKBNAU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|