C16H14F3N5O3 — CID 102165595
2-(trifluoromethyl)-N-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzamide (PubChem CID 102165595) has the molecular formula C16H14F3N5O3 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-(trifluoromethyl)-N-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzamide.
| Compound Name | 2-(trifluoromethyl)-N-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzamide |
|---|---|
| PubChem CID | 102165595 |
| Molecular Formula | C16H14F3N5O3 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(trifluoromethyl)-N-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzamide |
| SMILES | Cn1c(=O)c2c(nc(NC(=O)c3ccccc3C(F)(F)F)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H14F3N5O3/c1-22-10-11(23(2)15(27)24(3)13(10)26)20-14(22)21-12(25)8-6-4-5-7-9(8)16(17,18)19/h4-7H,1-3H3,(H,20,21,25) |
| InChIKey | PXTIYXOXNFFVKL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |