C12H12F3N5O2 — CID 138051378
N-[1-(2-methoxyethyl)tetrazol-5-yl]-2-(trifluoromethyl)benzamide (PubChem CID 138051378) has the molecular formula C12H12F3N5O2 and a molecular weight of 315.25 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)tetrazol-5-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(2-methoxyethyl)tetrazol-5-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 138051378 |
| Molecular Formula | C12H12F3N5O2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-[1-(2-methoxyethyl)tetrazol-5-yl]-2-(trifluoromethyl)benzamide |
| SMILES | COCCn1nnnc1NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N5O2/c1-22-7-6-20-11(17-18-19-20)16-10(21)8-4-2-3-5-9(8)12(13,14)15/h2-5H,6-7H2,1H3,(H,16,17,19,21) |
| InChIKey | GJDIVWGRCFYQHQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |