C12H12F3N5O2S — CID 118639448
3-methoxysulfanyl-2-methyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 118639448) has the molecular formula C12H12F3N5O2S and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-methoxysulfanyl-2-methyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 3-methoxysulfanyl-2-methyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118639448 |
| Molecular Formula | C12H12F3N5O2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-methoxysulfanyl-2-methyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | COSc1c(C(F)(F)F)ccc(C(=O)Nc2nnnn2C)c1C |
| InChI | InChI=1S/C12H12F3N5O2S/c1-6-7(10(21)16-11-17-18-19-20(11)2)4-5-8(12(13,14)15)9(6)23-22-3/h4-5H,1-3H3,(H,16,17,19,21) |
| InChIKey | MESDMSHZSWANDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|