C11H9F4N5OS — CID 151659263
3-fluoro-2-methylsulfanyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 151659263) has the molecular formula C11H9F4N5OS and a molecular weight of 335.29 g/mol. Its IUPAC name is 3-fluoro-2-methylsulfanyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-2-methylsulfanyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 151659263 |
| Molecular Formula | C11H9F4N5OS |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-fluoro-2-methylsulfanyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CSc1c(C(=O)Nc2nnnn2C)ccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C11H9F4N5OS/c1-20-10(17-18-19-20)16-9(21)5-3-4-6(11(13,14)15)7(12)8(5)22-2/h3-4H,1-2H3,(H,16,17,19,21) |
| InChIKey | QWEMAJUPFSBIIT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |