C9H8F3N7O2 — CID 86763472
1-methyl-N-(1-methyltetrazol-5-yl)-6-oxo-5-(trifluoromethyl)pyrimidine-2-carboxamide (PubChem CID 86763472) has the molecular formula C9H8F3N7O2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-methyl-N-(1-methyltetrazol-5-yl)-6-oxo-5-(trifluoromethyl)pyrimidine-2-carboxamide.
| Compound Name | 1-methyl-N-(1-methyltetrazol-5-yl)-6-oxo-5-(trifluoromethyl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 86763472 |
| Molecular Formula | C9H8F3N7O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-methyl-N-(1-methyltetrazol-5-yl)-6-oxo-5-(trifluoromethyl)pyrimidine-2-carboxamide |
| SMILES | Cn1nnnc1NC(=O)c1ncc(C(F)(F)F)c(=O)n1C |
| InChI | InChI=1S/C9H8F3N7O2/c1-18-5(6(20)14-8-15-16-17-19(8)2)13-3-4(7(18)21)9(10,11)12/h3H,1-2H3,(H,14,15,17,20) |
| InChIKey | PWMDTMPTKJHYLD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |