C4H8N6O — CID 130735572
1-methyl-3-(1-methyltetrazol-5-yl)urea (PubChem CID 130735572) has the molecular formula C4H8N6O and a molecular weight of 156.15 g/mol. Its IUPAC name is 1-methyl-3-(1-methyltetrazol-5-yl)urea.
| Compound Name | 1-methyl-3-(1-methyltetrazol-5-yl)urea |
|---|---|
| PubChem CID | 130735572 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 1-methyl-3-(1-methyltetrazol-5-yl)urea |
| SMILES | CNC(=O)Nc1nnnn1C |
| InChI | InChI=1S/C4H8N6O/c1-5-4(11)6-3-7-8-9-10(3)2/h1-2H3,(H2,5,6,7,9,11) |
| InChIKey | ZFKVKURGLVVCRN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |