C11H11N6O2Y- — CID 177043614
2-methyl-3-N-(1-methyltetrazol-5-yl)benzene-6-ide-1,3-dicarboxamide;yttrium (PubChem CID 177043614) has the molecular formula C11H11N6O2Y- and a molecular weight of 348.16 g/mol. Its IUPAC name is 2-methyl-3-N-(1-methyltetrazol-5-yl)benzene-6-ide-1,3-dicarboxamide;yttrium.
| Compound Name | 2-methyl-3-N-(1-methyltetrazol-5-yl)benzene-6-ide-1,3-dicarboxamide;yttrium |
|---|---|
| PubChem CID | 177043614 |
| Molecular Formula | C11H11N6O2Y- |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 2-methyl-3-N-(1-methyltetrazol-5-yl)benzene-6-ide-1,3-dicarboxamide;yttrium |
| SMILES | Cc1c(C(N)=O)[c-]ccc1C(=O)Nc1nnnn1C.[Y] |
| InChI | InChI=1S/C11H11N6O2.Y/c1-6-7(9(12)18)4-3-5-8(6)10(19)13-11-14-15-16-17(11)2;/h3,5H,1-2H3,(H2,12,18)(H,13,14,16,19);/q-1; |
| InChIKey | MNYOIDODUAMYCO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|