C13H16ClN7O2 — CID 146606392
4-chloro-3-(dimethylcarbamoylamino)-2-methyl-N-(1-methyltetrazol-5-yl)benzamide (PubChem CID 146606392) has the molecular formula C13H16ClN7O2 and a molecular weight of 337.77 g/mol. Its IUPAC name is 4-chloro-3-(dimethylcarbamoylamino)-2-methyl-N-(1-methyltetrazol-5-yl)benzamide.
| Compound Name | 4-chloro-3-(dimethylcarbamoylamino)-2-methyl-N-(1-methyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 146606392 |
| Molecular Formula | C13H16ClN7O2 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-chloro-3-(dimethylcarbamoylamino)-2-methyl-N-(1-methyltetrazol-5-yl)benzamide |
| SMILES | Cc1c(C(=O)Nc2nnnn2C)ccc(Cl)c1NC(=O)N(C)C |
| InChI | InChI=1S/C13H16ClN7O2/c1-7-8(11(22)16-12-17-18-19-21(12)4)5-6-9(14)10(7)15-13(23)20(2)3/h5-6H,1-4H3,(H,15,23)(H,16,17,19,22) |
| InChIKey | SYVXGXVKSQCZLS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |