C3H6N6O — CID 130674530
(1-methyltetrazol-5-yl)urea (PubChem CID 130674530) has the molecular formula C3H6N6O and a molecular weight of 142.12 g/mol. Its IUPAC name is (1-methyltetrazol-5-yl)urea.
| Compound Name | (1-methyltetrazol-5-yl)urea |
|---|---|
| PubChem CID | 130674530 |
| Molecular Formula | C3H6N6O |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1-methyltetrazol-5-yl)urea |
| SMILES | Cn1nnnc1NC(N)=O |
| InChI | InChI=1S/C3H6N6O/c1-9-3(5-2(4)10)6-7-8-9/h1H3,(H3,4,5,6,8,10) |
| InChIKey | IMWNRXTZLSCIRM-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |