C18H21N7O4 — CID 3368149
2-[2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)hydrazinylidene]propoxy]benzamide (PubChem CID 3368149) has the molecular formula C18H21N7O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)hydrazinylidene]propoxy]benzamide.
| Compound Name | 2-[2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)hydrazinylidene]propoxy]benzamide |
|---|---|
| PubChem CID | 3368149 |
| Molecular Formula | C18H21N7O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[2-[(1,3,7-trimethyl-2,6-dioxopurin-8-yl)hydrazinylidene]propoxy]benzamide |
| SMILES | CC(COc1ccccc1C(N)=O)=NNc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H21N7O4/c1-10(9-29-12-8-6-5-7-11(12)14(19)26)21-22-17-20-15-13(23(17)2)16(27)25(4)18(28)24(15)3/h5-8H,9H2,1-4H3,(H2,19,26)(H,20,22) |
| InChIKey | QEAHEWMBCGUNGU-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|