C16H18N6O3 — CID 699817
2-[8-(benzylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide (PubChem CID 699817) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-[8-(benzylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide.
| Compound Name | 2-[8-(benzylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide |
|---|---|
| PubChem CID | 699817 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[8-(benzylamino)-1,3-dimethyl-2,6-dioxopurin-7-yl]acetamide |
| SMILES | Cn1c(=O)c2c(nc(NCc3ccccc3)n2CC(N)=O)n(C)c1=O |
| InChI | InChI=1S/C16H18N6O3/c1-20-13-12(14(24)21(2)16(20)25)22(9-11(17)23)15(19-13)18-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H2,17,23)(H,18,19) |
| InChIKey | PMZKEYAIUGEWAK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |