C22H29N7O3 — CID 110175097
1-benzyl-3-[1,3-dimethyl-2,6-dioxo-7-(3-pyrrolidin-1-ylpropyl)purin-8-yl]urea (PubChem CID 110175097) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-benzyl-3-[1,3-dimethyl-2,6-dioxo-7-(3-pyrrolidin-1-ylpropyl)purin-8-yl]urea.
| Compound Name | 1-benzyl-3-[1,3-dimethyl-2,6-dioxo-7-(3-pyrrolidin-1-ylpropyl)purin-8-yl]urea |
|---|---|
| PubChem CID | 110175097 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-benzyl-3-[1,3-dimethyl-2,6-dioxo-7-(3-pyrrolidin-1-ylpropyl)purin-8-yl]urea |
| SMILES | Cn1c(=O)c2c(nc(NC(=O)NCc3ccccc3)n2CCCN2CCCC2)n(C)c1=O |
| InChI | InChI=1S/C22H29N7O3/c1-26-18-17(19(30)27(2)22(26)32)29(14-8-13-28-11-6-7-12-28)20(24-18)25-21(31)23-15-16-9-4-3-5-10-16/h3-5,9-10H,6-8,11-15H2,1-2H3,(H2,23,24,25,31) |
| InChIKey | ZPNMULFFFPEBFY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |