C23H23N5O4 — CID 7005332
(2R)-2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]-3-phenylpropanoic acid (PubChem CID 7005332) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is (2R)-2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 7005332 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2R)-2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]-3-phenylpropanoic acid |
| SMILES | Cn1c(=O)c2c(nc(N[C@H](Cc3ccccc3)C(=O)O)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H23N5O4/c1-26-19-18(20(29)27(2)23(26)32)28(14-16-11-7-4-8-12-16)22(25-19)24-17(21(30)31)13-15-9-5-3-6-10-15/h3-12,17H,13-14H2,1-2H3,(H,24,25)(H,30,31)/t17-/m1/s1 |
| InChIKey | WRTUNDXZORICHG-QGZVFWFLSA-N |
| XLogP | 1.59 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |