C20H25N5O4 — CID 2729715
2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]butyl acetate (PubChem CID 2729715) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]butyl acetate.
| Compound Name | 2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]butyl acetate |
|---|---|
| PubChem CID | 2729715 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)amino]butyl acetate |
| SMILES | CCC(COC(C)=O)Nc1nc2c(c(=O)n(C)c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H25N5O4/c1-5-15(12-29-13(2)26)21-19-22-17-16(18(27)24(4)20(28)23(17)3)25(19)11-14-9-7-6-8-10-14/h6-10,15H,5,11-12H2,1-4H3,(H,21,22) |
| InChIKey | UUOIOFDCNXIEAQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |