C15H18N6O2 — CID 663453
7-ethyl-1,3-dimethyl-8-(pyridin-2-ylmethylamino)purine-2,6-dione (PubChem CID 663453) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-(pyridin-2-ylmethylamino)purine-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-(pyridin-2-ylmethylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 663453 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-(pyridin-2-ylmethylamino)purine-2,6-dione |
| SMILES | CCn1c(NCc2ccccn2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H18N6O2/c1-4-21-11-12(19(2)15(23)20(3)13(11)22)18-14(21)17-9-10-7-5-6-8-16-10/h5-8H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | DWLUQZHZDLIOEP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |