C14H14N6O3 — CID 134517917
1,3-dimethyl-2,6-dioxo-N-(pyridin-2-ylmethyl)purine-7-carboxamide (PubChem CID 134517917) has the molecular formula C14H14N6O3 and a molecular weight of 314.31 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-dioxo-N-(pyridin-2-ylmethyl)purine-7-carboxamide.
| Compound Name | 1,3-dimethyl-2,6-dioxo-N-(pyridin-2-ylmethyl)purine-7-carboxamide |
|---|---|
| PubChem CID | 134517917 |
| Molecular Formula | C14H14N6O3 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1,3-dimethyl-2,6-dioxo-N-(pyridin-2-ylmethyl)purine-7-carboxamide |
| SMILES | Cn1c(=O)c2c(ncn2C(=O)NCc2ccccn2)n(C)c1=O |
| InChI | InChI=1S/C14H14N6O3/c1-18-11-10(12(21)19(2)14(18)23)20(8-17-11)13(22)16-7-9-5-3-4-6-15-9/h3-6,8H,7H2,1-2H3,(H,16,22) |
| InChIKey | MPUDLINZMDLKLW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |