C11H12N3O3S- — CID 7659258
2-[(2Z)-2-(carbamothioylhydrazinylidene)propoxy]benzoate (PubChem CID 7659258) has the molecular formula C11H12N3O3S- and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(2Z)-2-(carbamothioylhydrazinylidene)propoxy]benzoate.
| Compound Name | 2-[(2Z)-2-(carbamothioylhydrazinylidene)propoxy]benzoate |
|---|---|
| PubChem CID | 7659258 |
| Molecular Formula | C11H12N3O3S- |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[(2Z)-2-(carbamothioylhydrazinylidene)propoxy]benzoate |
| SMILES | C/C(COc1ccccc1C(=O)[O-])=N/NC(N)=S |
| InChI | InChI=1S/C11H13N3O3S/c1-7(13-14-11(12)18)6-17-9-5-3-2-4-8(9)10(15)16/h2-5H,6H2,1H3,(H,15,16)(H3,12,14,18)/p-1/b13-7- |
| InChIKey | KUUHROWHFCYKRJ-QPEQYQDCSA-M |
| XLogP | -0.36 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|