C10H13N3O2S — CID 7346890
[(E)-1-(2-hydroxyphenoxy)propan-2-ylideneamino]thiourea (PubChem CID 7346890) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is [(E)-1-(2-hydroxyphenoxy)propan-2-ylideneamino]thiourea.
| Compound Name | [(E)-1-(2-hydroxyphenoxy)propan-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 7346890 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | [(E)-1-(2-hydroxyphenoxy)propan-2-ylideneamino]thiourea |
| SMILES | C/C(COc1ccccc1O)=N\NC(N)=S |
| InChI | InChI=1S/C10H13N3O2S/c1-7(12-13-10(11)16)6-15-9-5-3-2-4-8(9)14/h2-5,14H,6H2,1H3,(H3,11,13,16)/b12-7+ |
| InChIKey | HJBBBUNOBNQWJE-KPKJPENVSA-N |
| XLogP | 0.98 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|