C12H13N5OS2 — CID 6148373
[(E)-1-[4-(thiadiazol-4-yl)phenoxy]propan-2-ylideneamino]thiourea (PubChem CID 6148373) has the molecular formula C12H13N5OS2 and a molecular weight of 307.40 g/mol. Its IUPAC name is [(E)-1-[4-(thiadiazol-4-yl)phenoxy]propan-2-ylideneamino]thiourea.
| Compound Name | [(E)-1-[4-(thiadiazol-4-yl)phenoxy]propan-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 6148373 |
| Molecular Formula | C12H13N5OS2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [(E)-1-[4-(thiadiazol-4-yl)phenoxy]propan-2-ylideneamino]thiourea |
| SMILES | C/C(COc1ccc(-c2csnn2)cc1)=N\NC(N)=S |
| InChI | InChI=1S/C12H13N5OS2/c1-8(14-16-12(13)19)6-18-10-4-2-9(3-5-10)11-7-20-17-15-11/h2-5,7H,6H2,1H3,(H3,13,16,19)/b14-8+ |
| InChIKey | RXJPURMCCPUZLR-RIYZIHGNSA-N |
| XLogP | 1.79 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|