C14H16N4O2S — CID 2739346
[[amino-[4-(thiadiazol-4-yl)phenyl]methylidene]amino] 2,2-dimethylpropanoate (PubChem CID 2739346) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is [[amino-[4-(thiadiazol-4-yl)phenyl]methylidene]amino] 2,2-dimethylpropanoate.
| Compound Name | [[amino-[4-(thiadiazol-4-yl)phenyl]methylidene]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 2739346 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [[amino-[4-(thiadiazol-4-yl)phenyl]methylidene]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON=C(N)c1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C14H16N4O2S/c1-14(2,3)13(19)20-17-12(15)10-6-4-9(5-7-10)11-8-21-18-16-11/h4-8H,1-3H3,(H2,15,17) |
| InChIKey | QWZWXSSZKBNZBE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|