C17H19N3O2 — CID 4574737
[[amino(pyridin-4-yl)methylidene]amino] 4-tert-butylbenzoate (PubChem CID 4574737) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is [[amino(pyridin-4-yl)methylidene]amino] 4-tert-butylbenzoate.
| Compound Name | [[amino(pyridin-4-yl)methylidene]amino] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 4574737 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [[amino(pyridin-4-yl)methylidene]amino] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)ON=C(N)c2ccncc2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-17(2,3)14-6-4-13(5-7-14)16(21)22-20-15(18)12-8-10-19-11-9-12/h4-11H,1-3H3,(H2,18,20) |
| InChIKey | JEWPDHDEDXFRHE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|