C19H14F3N3O2S — CID 2744130
[[amino-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methylidene]amino] 4-(trifluoromethyl)benzoate (PubChem CID 2744130) has the molecular formula C19H14F3N3O2S and a molecular weight of 405.40 g/mol. Its IUPAC name is [[amino-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methylidene]amino] 4-(trifluoromethyl)benzoate.
| Compound Name | [[amino-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methylidene]amino] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2744130 |
| Molecular Formula | C19H14F3N3O2S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [[amino-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]methylidene]amino] 4-(trifluoromethyl)benzoate |
| SMILES | Cc1nc(-c2ccc(C(N)=NOC(=O)c3ccc(C(F)(F)F)cc3)cc2)cs1 |
| InChI | InChI=1S/C19H14F3N3O2S/c1-11-24-16(10-28-11)12-2-4-13(5-3-12)17(23)25-27-18(26)14-6-8-15(9-7-14)19(20,21)22/h2-10H,1H3,(H2,23,25) |
| InChIKey | WNPGMMYBLWMVIU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|