C11H10N2O2S — CID 167927329
N-hydroxy-4-(2-methyl-1,3-thiazol-4-yl)benzamide (PubChem CID 167927329) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is N-hydroxy-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-hydroxy-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 167927329 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-hydroxy-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)NO)cc2)cs1 |
| InChI | InChI=1S/C11H10N2O2S/c1-7-12-10(6-16-7)8-2-4-9(5-3-8)11(14)13-15/h2-6,15H,1H3,(H,13,14) |
| InChIKey | AVECGIJPZILCBZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|