C18H16N2OS — CID 53037594
N-(2-methylphenyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide (PubChem CID 53037594) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-(2-methylphenyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 53037594 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(2-methylphenyl)-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)Nc3ccccc3C)cc2)cs1 |
| InChI | InChI=1S/C18H16N2OS/c1-12-5-3-4-6-16(12)20-18(21)15-9-7-14(8-10-15)17-11-22-13(2)19-17/h3-11H,1-2H3,(H,20,21) |
| InChIKey | VBRDDENXNUSPRO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |