C15H15N3O4 — CID 3146337
[[amino(pyridin-4-yl)methylidene]amino] 3,4-dimethoxybenzoate (PubChem CID 3146337) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is [[amino(pyridin-4-yl)methylidene]amino] 3,4-dimethoxybenzoate.
| Compound Name | [[amino(pyridin-4-yl)methylidene]amino] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 3146337 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [[amino(pyridin-4-yl)methylidene]amino] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C(N)c2ccncc2)cc1OC |
| InChI | InChI=1S/C15H15N3O4/c1-20-12-4-3-11(9-13(12)21-2)15(19)22-18-14(16)10-5-7-17-8-6-10/h3-9H,1-2H3,(H2,16,18) |
| InChIKey | YSUFCWUNNFANLD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|