C15H16N3O4+ — CID 135461589
[[amino(pyridin-1-ium-2-yl)methylidene]amino] 3,4-dimethoxybenzoate (PubChem CID 135461589) has the molecular formula C15H16N3O4+ and a molecular weight of 302.31 g/mol. Its IUPAC name is [[amino(pyridin-1-ium-2-yl)methylidene]amino] 3,4-dimethoxybenzoate.
| Compound Name | [[amino(pyridin-1-ium-2-yl)methylidene]amino] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 135461589 |
| Molecular Formula | C15H16N3O4+ |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [[amino(pyridin-1-ium-2-yl)methylidene]amino] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C(N)c2cccc[nH+]2)cc1OC |
| InChI | InChI=1S/C15H15N3O4/c1-20-12-7-6-10(9-13(12)21-2)15(19)22-18-14(16)11-5-3-4-8-17-11/h3-9H,1-2H3,(H2,16,18)/p+1 |
| InChIKey | YSTZVPDUPBOACA-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|