C16H14Cl2N2O4 — CID 19293781
[(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-dimethoxybenzoate (PubChem CID 19293781) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-dimethoxybenzoate.
| Compound Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 19293781 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [(Z)-[amino-(2,4-dichlorophenyl)methylidene]amino] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)O/N=C(\N)c2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C16H14Cl2N2O4/c1-22-13-6-3-9(7-14(13)23-2)16(21)24-20-15(19)11-5-4-10(17)8-12(11)18/h3-8H,1-2H3,(H2,19,20) |
| InChIKey | YJLPOESTBSLPCB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|