C9H6ClF3N2O2 — CID 19291930
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate (PubChem CID 19291930) has the molecular formula C9H6ClF3N2O2 and a molecular weight of 266.61 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate |
|---|---|
| PubChem CID | 19291930 |
| Molecular Formula | C9H6ClF3N2O2 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] 2-chloro-2,2-difluoroacetate |
| SMILES | N/C(=N\OC(=O)C(F)(F)Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H6ClF3N2O2/c10-9(12,13)8(16)17-15-7(14)5-1-3-6(11)4-2-5/h1-4H,(H2,14,15) |
| InChIKey | YMTGIQIWQJWODX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|