C14H17FN2O2 — CID 19292035
[(Z)-[amino-(4-fluorophenyl)methylidene]amino] cyclohexanecarboxylate (PubChem CID 19292035) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is [(Z)-[amino-(4-fluorophenyl)methylidene]amino] cyclohexanecarboxylate.
| Compound Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 19292035 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [(Z)-[amino-(4-fluorophenyl)methylidene]amino] cyclohexanecarboxylate |
| SMILES | N/C(=N\OC(=O)C1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O2/c15-12-8-6-10(7-9-12)13(16)17-19-14(18)11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H2,16,17) |
| InChIKey | SPGIECBQPWYYMU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|