C21H20FNO2 — CID 40549783
[(E)-[(4-fluorophenyl)-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate (PubChem CID 40549783) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is [(E)-[(4-fluorophenyl)-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate.
| Compound Name | [(E)-[(4-fluorophenyl)-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 40549783 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(E)-[(4-fluorophenyl)-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate |
| SMILES | Cc1ccc([C@@H]2C[C@H]2/C(=N\OC(=O)C2CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H20FNO2/c1-13-2-4-14(5-3-13)18-12-19(18)20(15-8-10-17(22)11-9-15)23-25-21(24)16-6-7-16/h2-5,8-11,16,18-19H,6-7,12H2,1H3/b23-20-/t18-,19+/m0/s1 |
| InChIKey | NERKTQZFNARWSS-FTTJAJSTSA-N |
| XLogP | 4.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|