C20H17BrClNO2 — CID 40822686
[(E)-[(4-bromophenyl)-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate (PubChem CID 40822686) has the molecular formula C20H17BrClNO2 and a molecular weight of 418.72 g/mol. Its IUPAC name is [(E)-[(4-bromophenyl)-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate.
| Compound Name | [(E)-[(4-bromophenyl)-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 40822686 |
| Molecular Formula | C20H17BrClNO2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | [(E)-[(4-bromophenyl)-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]methylidene]amino] cyclopropanecarboxylate |
| SMILES | O=C(O/N=C(/c1ccc(Br)cc1)[C@@H]1C[C@@H]1c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C20H17BrClNO2/c21-15-7-3-13(4-8-15)19(23-25-20(24)14-1-2-14)18-11-17(18)12-5-9-16(22)10-6-12/h3-10,14,17-18H,1-2,11H2/b23-19-/t17-,18-/m1/s1 |
| InChIKey | XKQSPHMBCFUQNJ-BSYQWNDESA-N |
| XLogP | 5.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|