C15H13ClN2O2S — CID 19296353
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 2-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 19296353) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 2-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 2-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19296353 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 2-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | N/C(=N\OC(=O)C1CC1c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C15H13ClN2O2S/c16-10-5-3-9(4-6-10)11-8-12(11)15(19)20-18-14(17)13-2-1-7-21-13/h1-7,11-12H,8H2,(H2,17,18) |
| InChIKey | KKZMHYAMMIWCJX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|