C17H18ClN3O4S2 — CID 19324347
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 19324347) has the molecular formula C17H18ClN3O4S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 19324347 |
| Molecular Formula | C17H18ClN3O4S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-(4-chlorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | N/C(=N\OC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H18ClN3O4S2/c18-13-3-5-14(6-4-13)27(23,24)21-9-7-12(8-10-21)17(22)25-20-16(19)15-2-1-11-26-15/h1-6,11-12H,7-10H2,(H2,19,20) |
| InChIKey | VRKXEYAWUVUHJL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|