C20H23ClN2O3S2 — CID 1452394
1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 1452394) has the molecular formula C20H23ClN2O3S2 and a molecular weight of 439.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1452394 |
| Molecular Formula | C20H23ClN2O3S2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-cyclopropyl-N-(thiophen-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C20H23ClN2O3S2/c21-16-3-7-19(8-4-16)28(25,26)22-11-9-15(10-12-22)20(24)23(17-5-6-17)14-18-2-1-13-27-18/h1-4,7-8,13,15,17H,5-6,9-12,14H2 |
| InChIKey | DJPQUXXCYGTONO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |