C21H26N2O3S2 — CID 90496092
N-cyclopropyl-4-piperidin-1-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 90496092) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-cyclopropyl-4-piperidin-1-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | N-cyclopropyl-4-piperidin-1-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 90496092 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-cyclopropyl-4-piperidin-1-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCCC2)cc1)N(CCc1cccs1)C1CC1 |
| InChI | InChI=1S/C21H26N2O3S2/c24-21(23(18-8-9-18)15-12-19-5-4-16-27-19)17-6-10-20(11-7-17)28(25,26)22-13-2-1-3-14-22/h4-7,10-11,16,18H,1-3,8-9,12-15H2 |
| InChIKey | BRTUNZAQEQNYRR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |