C22H24N2O5S2 — CID 90583280
N-(furan-3-ylmethyl)-4-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 90583280) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-4-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | N-(furan-3-ylmethyl)-4-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 90583280 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(furan-3-ylmethyl)-4-morpholin-4-ylsulfonyl-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCOCC2)cc1)N(CCc1cccs1)Cc1ccoc1 |
| InChI | InChI=1S/C22H24N2O5S2/c25-22(23(16-18-8-12-29-17-18)9-7-20-2-1-15-30-20)19-3-5-21(6-4-19)31(26,27)24-10-13-28-14-11-24/h1-6,8,12,15,17H,7,9-11,13-14,16H2 |
| InChIKey | PBYOEZFETSPUAQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |