C20H21NO4S — CID 90583211
N-(furan-3-ylmethyl)-3,4-dimethoxy-N-(2-thiophen-2-ylethyl)benzamide (PubChem CID 90583211) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-3,4-dimethoxy-N-(2-thiophen-2-ylethyl)benzamide.
| Compound Name | N-(furan-3-ylmethyl)-3,4-dimethoxy-N-(2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 90583211 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-3,4-dimethoxy-N-(2-thiophen-2-ylethyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCc2cccs2)Cc2ccoc2)cc1OC |
| InChI | InChI=1S/C20H21NO4S/c1-23-18-6-5-16(12-19(18)24-2)20(22)21(13-15-8-10-25-14-15)9-7-17-4-3-11-26-17/h3-6,8,10-12,14H,7,9,13H2,1-2H3 |
| InChIKey | GVALAIJDHIASRS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |