C20H21NO4S2 — CID 90583258
3-(benzenesulfonyl)-N-(furan-3-ylmethyl)-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 90583258) has the molecular formula C20H21NO4S2 and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(furan-3-ylmethyl)-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(furan-3-ylmethyl)-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 90583258 |
| Molecular Formula | C20H21NO4S2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(furan-3-ylmethyl)-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)N(CCc1cccs1)Cc1ccoc1 |
| InChI | InChI=1S/C20H21NO4S2/c22-20(10-14-27(23,24)19-6-2-1-3-7-19)21(15-17-9-12-25-16-17)11-8-18-5-4-13-26-18/h1-7,9,12-13,16H,8,10-11,14-15H2 |
| InChIKey | BSEKEPHZVYOUKI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |