C16H16N2O2S2 — CID 90583109
1-(furan-3-ylmethyl)-1,3-bis(thiophen-2-ylmethyl)urea (PubChem CID 90583109) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-1,3-bis(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(furan-3-ylmethyl)-1,3-bis(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 90583109 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(furan-3-ylmethyl)-1,3-bis(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1cccs1)N(Cc1ccoc1)Cc1cccs1 |
| InChI | InChI=1S/C16H16N2O2S2/c19-16(17-9-14-3-1-7-21-14)18(10-13-5-6-20-12-13)11-15-4-2-8-22-15/h1-8,12H,9-11H2,(H,17,19) |
| InChIKey | WJCIHUBVQSCDMK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |