C19H20N2O5S2 — CID 72717975
methyl N-[4-[furan-3-ylmethyl(2-thiophen-2-ylethyl)sulfamoyl]phenyl]carbamate (PubChem CID 72717975) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is methyl N-[4-[furan-3-ylmethyl(2-thiophen-2-ylethyl)sulfamoyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[furan-3-ylmethyl(2-thiophen-2-ylethyl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 72717975 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | methyl N-[4-[furan-3-ylmethyl(2-thiophen-2-ylethyl)sulfamoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)N(CCc2cccs2)Cc2ccoc2)cc1 |
| InChI | InChI=1S/C19H20N2O5S2/c1-25-19(22)20-16-4-6-18(7-5-16)28(23,24)21(13-15-9-11-26-14-15)10-8-17-3-2-12-27-17/h2-7,9,11-12,14H,8,10,13H2,1H3,(H,20,22) |
| InChIKey | FLLQRPHVPKXFFV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |